| product Name |
Allyl alcohol |
| Synonyms |
2-PROPENE-1-OL; 2-PROPEN-1-OL; 2-PROPENOL; ALLYL ALCOHOL, POLYMER-BOUND; 1-propene-3-ol; 1-propenol-[3]; prop-2-en-1-ol; prop-1-en-2-ol |
| Molecular Formula |
C3H6O |
| Molecular Weight |
58.0791 |
| InChI |
InChI=1/C3H6O/c1-3(2)4/h4H,1H2,2H3 |
| CAS Registry Number |
107-18-6 |
| EINECS |
203-470-7 |
| Molecular Structure |
|
| Density |
0.824g/cm3 |
| Melting point |
-129℃ |
| Boiling point |
54.3°C at 760 mmHg |
| Refractive index |
1.399 |
| Water solubility |
MISCIBLE |
| Vapour Pressur |
199mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
N:Dangerous for the environment;
|
| Risk Codes |
R10:;
R23/24/25:;
R36/37/38:;
R50:;
|
| Safety Description |
S36/37/39:;
S38:;
S45:;
S61:;
|
|