| product Name |
Butyl epoxystearate |
| Synonyms |
203-434-0; Butyl 8-(3-octyloxiran-2-yl)octanoate |
| Molecular Formula |
C22H42O3 |
| Molecular Weight |
354.5671 |
| InChI |
InChI=1/C22H42O3/c1-3-5-7-8-10-13-16-20-21(25-20)17-14-11-9-12-15-18-22(23)24-19-6-4-2/h20-21H,3-19H2,1-2H3 |
| CAS Registry Number |
106-83-2 |
| EINECS |
203-434-0 |
| Molecular Structure |
|
| Density |
0.916g/cm3 |
| Boiling point |
428.8°C at 760 mmHg |
| Refractive index |
1.456 |
| Flash point |
163.2°C |
| Vapour Pressur |
1.47E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|