| product Name |
propane-1,2,3-triyl tris[3-(2-acetoxyoctyl)oxiran-2-octanoate] |
| Synonyms |
Propane-1,2,3-triyl tris(3-(2-acetoxyoctyl)oxiran-2-octanoate); propane-1,2,3-triyl tris(8-{3-[2-(acetyloxy)octyl]oxiran-2-yl}octanoate) |
| Molecular Formula |
C63H110O15 |
| Molecular Weight |
1107.5385 |
| InChI |
InChI=1/C63H110O15/c1-7-10-13-25-34-51(72-48(4)64)43-58-55(76-58)37-28-19-16-22-31-40-61(67)70-46-54(75-63(69)42-33-24-18-21-30-39-57-60(78-57)45-53(74-50(6)66)36-27-15-12-9-3)47-71-62(68)41-32-23-17-20-29-38-56-59(77-56)44-52(73-49(5)65)35-26-14-11-8-2/h51-60H,7-47H2,1-6H3 |
| CAS Registry Number |
106-80-9 |
| EINECS |
203-433-5 |
| Molecular Structure |
|
| Density |
1.038g/cm3 |
| Boiling point |
933.4°C at 760 mmHg |
| Refractive index |
1.48 |
| Flash point |
336.5°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|