| product Name |
P-Chlorophenol |
| Synonyms |
4-Chlorophenol solution; Parachlorophenol; Para chlorophenol; 4-chloro phenol; 4-chloro-1-hydroxybenzene; 4-chloro-pheno; 4-Chlorophenol(form2); 4-chloro-phenole; Applied 3-78; applied3-78; chlorophenols,solid; p-Chlorfenol; P-CHLORO PHENOL; 4-Hydroxychlorobenzene; 4-chlorophenol; Benzene, 1-chloro-4-ethoxy- |
| Molecular Formula |
C6H5ClO |
| Molecular Weight |
128.6095 |
| InChI |
InChI=1/C8H9ClO/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
| CAS Registry Number |
106-48-9 |
| EINECS |
203-402-6 |
| Molecular Structure |
|
| Density |
1.103g/cm3 |
| Melting point |
41-45℃ |
| Boiling point |
213°C at 760 mmHg |
| Refractive index |
1.51 |
| Flash point |
83.7°C |
| Water solubility |
2.7 g/100 mL (20℃) |
| Vapour Pressur |
0.245mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
N:Dangerous for the environment;
|
| Risk Codes |
R20/21/22:;
R51/53:;
|
| Safety Description |
S28A:;
S61:;
|
|