| product Name |
p-Toluenethiol |
| Synonyms |
4-Methylbenzenethiol; 4-Thiocresol = p-Thioresol; Toluenethiol; 4-Mercaptotoluene~4-Methylthiophenol~p-Toluenethiol; p-Thiocresol,(4-Mercaptotoluene; p-methylthiophenol; 4-methylbenzenethiolate |
| Molecular Formula |
C7H7S |
| Molecular Weight |
123.196 |
| InChI |
InChI=1/C7H8S/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3/p-1 |
| CAS Registry Number |
106-45-6 |
| EINECS |
203-399-1 |
| Molecular Structure |
|
| Melting point |
40-44℃ |
| Boiling point |
195°C at 760 mmHg |
| Flash point |
69.5°C |
| Water solubility |
slightly soluble |
| Vapour Pressur |
0.601mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:;
R36/37/38:;
|
| Safety Description |
S26:;
S36/37/39:;
|
|