| product Name |
Ethyl laurate |
| Synonyms |
Ethyl dodecanoate; Lauric acid ethyl ester; Dodecanoic acid ethyl ester |
| Molecular Formula |
C14H28O2 |
| Molecular Weight |
228.3709 |
| InChI |
InChI=1/C14H28O2/c1-3-5-6-7-8-9-10-11-12-13-14(15)16-4-2/h3-13H2,1-2H3 |
| CAS Registry Number |
106-33-2 |
| EINECS |
203-386-0 |
| Molecular Structure |
|
| Density |
0.867g/cm3 |
| Melting point |
-10℃ |
| Boiling point |
269°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
118.6°C |
| Water solubility |
insoluble |
| Vapour Pressur |
0.00744mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:;
S24/25:;
|
|