| product Name |
Trans,Trans-Farnesol |
| Synonyms |
trans,trans-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol; 3,7,11-trimethyldodeca-2,6,10-trien-1-ol; (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| Molecular Formula |
C15H26O |
| Molecular Weight |
222.3663 |
| InChI |
InChI=1/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| CAS Registry Number |
106-28-5 |
| EINECS |
225-004-1 |
| Molecular Structure |
|
| Density |
0.875g/cm3 |
| Boiling point |
283.4°C at 760 mmHg |
| Refractive index |
1.485 |
| Flash point |
112.5°C |
| Vapour Pressur |
0.00037mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
