| product Name |
Isoamyl n-Butyrate |
| Synonyms |
Butanoic acid, 3-methylbutyl ester; isopentyl butyrate; Isoamyl butyrate;
; 3-methylbutyl butanoate |
| Molecular Formula |
C9H18O2 |
| Molecular Weight |
158.238 |
| InChI |
InChI=1/C9H18O2/c1-4-5-9(10)11-7-6-8(2)3/h8H,4-7H2,1-3H3 |
| CAS Registry Number |
106-27-4 |
| EINECS |
203-380-8 |
| Molecular Structure |
|
| Density |
0.874g/cm3 |
| Melting point |
-73℃ |
| Boiling point |
176.5°C at 760 mmHg |
| Refractive index |
1.416 |
| Flash point |
57.8°C |
| Vapour Pressur |
1.09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
|