| product Name |
Citronellal |
| Synonyms |
3,7-Dimethyl-6-octenal; Natural Citronellal; 3,7-dimethyloct-6-enal; (4-chlorophenyl)(phenyl)methanone; (3R)-3,7-dimethyloct-6-enal |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m1/s1 |
| CAS Registry Number |
106-23-0 |
| EINECS |
203-376-6 |
| Molecular Structure |
|
| Density |
0.835g/cm3 |
| Boiling point |
208.4°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
75.6°C |
| Vapour Pressur |
0.215mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|