| product Name |
2-ethoxyethyl laurate |
| Synonyms |
Dodecanoic acid, 2-ethoxyethyl ester; 2-Ethoxyethyl dodecanoate; NSC 406279; 2-Ethoxyethyl laurate; Lauric acid, 2-ethoxyethyl ester (8CI) |
| Molecular Formula |
C16H32O3 |
| Molecular Weight |
272.4235 |
| InChI |
InChI=1/C16H32O3/c1-3-5-6-7-8-9-10-11-12-13-16(17)19-15-14-18-4-2/h3-15H2,1-2H3 |
| CAS Registry Number |
106-13-8 |
| EINECS |
203-365-6 |
| Molecular Structure |
|
| Density |
0.9g/cm3 |
| Boiling point |
349.1°C at 760 mmHg |
| Refractive index |
1.439 |
| Flash point |
124°C |
| Vapour Pressur |
4.81E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|