| product Name |
2,2'-ethylenedioxydiethyl dioctanoate |
| Synonyms |
Octanoic acid, 1,1'-(1,2-ethanediylbis(oxy-2,1-ethanediyl)) ester; NSC 6380; Octanoic acid, diester with triethylene glycol; Triethylene glycol dicaprylate; Triethylene glycol dioctanoate; 2,2'-Ethylenedioxydiethyl dioctanoate; Octanoic acid, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester; Octanoic acid, ethylenebis(oxyethylene) ester (8CI); ethane-1,2-diylbis(oxyethane-2,1-diyl) dioctanoate |
| Molecular Formula |
C22H42O6 |
| Molecular Weight |
402.5653 |
| InChI |
InChI=1/C22H42O6/c1-3-5-7-9-11-13-21(23)27-19-17-25-15-16-26-18-20-28-22(24)14-12-10-8-6-4-2/h3-20H2,1-2H3 |
| CAS Registry Number |
106-10-5 |
| EINECS |
203-361-4 |
| Molecular Structure |
|
| Density |
0.978g/cm3 |
| Boiling point |
471.1°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
198.2°C |
| Vapour Pressur |
4.77E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|