| product Name |
geranyl propionate |
| Synonyms |
2,6-Octadien-1-ol, 3,7-dimethyl-, 1-propanoate, (2E)-; (E)-3,7-Dimethyl-2,6-octadien-1-ol propionate; 2,6-Octadien-1-ol, 3,7-dimethyl-, propanoate, (E)-; 2,6-Octadien-1-ol, 3,7-dimethyl-, propionate, (E)-; 3,7-Dimethyl-2,6-octadien-1-yl propanoate, trans-; 3,7-Dimethyl-2,6-octadienyl propanoate, (E)-; 3,7-Dimethyl-2,6-octadienyl propionate, (E)-; AI3-24355; FEMA No. 2517; Geranyl propanoate; Geranyl propionate; Geranyl propionate (natural); Propionic acid, geranyl ester (6CI); UNII-U9F1RPB24G; trans-3,7-Dimethyl-2,6-octadien-1-yl propionate; 2,6-Octadien-1-ol, 3,7-dimethyl-, propanoate, (2E)-; 2,6-Octadien-1-ol, 3,7-dimethyl-, propionate, (E)- (8CI); 3,7-dimethylocta-2,6-dien-1-yl propanoate; (2E)-3,7-dimethylocta-2,6-dien-1-yl propanoate; 2,6-dimethyloct-2-ene-6,7,8-triyl |
| Molecular Formula |
C10H17 |
| Molecular Weight |
137.242 |
| InChI |
InChI=1/C10H17/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,6,8H2,2-4H3 |
| CAS Registry Number |
105-90-8 |
| EINECS |
203-344-1 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|