| product Name |
N-Allyl-N'-2-hydroxyethylthiourea |
| Synonyms |
1-Allyl-3-(2-hydroxyethyl)-2-thiourea; 1-(2-hydroxyethyl)-3-prop-2-en-1-ylthiourea; 2-amino-4-bromobenzenethiol |
| Molecular Formula |
C6H6BrNS |
| Molecular Weight |
204.0875 |
| InChI |
InChI=1/C6H6BrNS/c7-4-1-2-6(9)5(8)3-4/h1-3,9H,8H2 |
| CAS Registry Number |
105-81-7 |
| EINECS |
203-334-7 |
| Molecular Structure |
|
| Density |
1.694g/cm3 |
| Melting point |
77-79℃ |
| Boiling point |
295.535°C at 760 mmHg |
| Refractive index |
1.696 |
| Flash point |
132.535°C |
| Vapour Pressur |
0.002mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|