| product Name |
Dibutyl fumarate |
| Synonyms |
2-Butenedioic acid (2E)-, 1,4-dibutyl ester; 4-02-00-02210 (Beilstein Handbook Reference); AI3-09505; BRN 1726635; Butyl fumarate; Dibutylester kyseliny fumarove; Dibutylester kyseliny fumarove [Czech]; Fumaric acid, di-n-butyl ester; NSC 140; RC Comonomer DBF; Stafex DBF; Staflex DBF; 2-Butenedioic acid (2E)-, dibutyl ester; 2-Butenedioic acid (E)-, dibutyl ester (9CI); 2-Butenedioic acid, dibutyl ester, (E)-; Fumaric acid, dibutyl ester; dibutyl but-2-enedioate; dibutyl (2Z)-but-2-enedioate; dibutyl (2E)-but-2-enedioate |
| Molecular Formula |
C12H20O4 |
| Molecular Weight |
228.2848 |
| InChI |
InChI=1/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7+ |
| CAS Registry Number |
105-75-9 |
| EINECS |
203-327-9 |
| Molecular Structure |
|
| Density |
1.004g/cm3 |
| Boiling point |
280°C at 760 mmHg |
| Refractive index |
1.451 |
| Flash point |
136.4°C |
| Vapour Pressur |
0.00388mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
|