| product Name |
dioleyl maleate |
| Synonyms |
Dioleyl maleate; di-(9E)-octadec-9-en-1-yl (2E)-but-2-enedioate |
| Molecular Formula |
C40H72O4 |
| Molecular Weight |
616.9973 |
| InChI |
InChI=1/C40H72O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-43-39(41)35-36-40(42)44-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,35-36H,3-16,21-34,37-38H2,1-2H3/b19-17+,20-18+,36-35+ |
| CAS Registry Number |
105-73-7 |
| EINECS |
203-325-8 |
| Molecular Structure |
|
| Density |
0.911g/cm3 |
| Boiling point |
665.3°C at 760 mmHg |
| Refractive index |
1.476 |
| Flash point |
316.6°C |
| Vapour Pressur |
1.43E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|