| product Name |
N,N,N'-Triethylethylenediamine |
| Synonyms |
diethyl(2-ethylaminoethyl)amine; N,N,N'-triethylethane-1,2-diamine; N,N,N'-triethylethane-1,2-diaminium |
| Molecular Formula |
C8H22N2 |
| Molecular Weight |
146.2726 |
| InChI |
InChI=1/C8H20N2/c1-4-9-7-8-10(5-2)6-3/h9H,4-8H2,1-3H3/p+2 |
| CAS Registry Number |
105-04-4 |
| EINECS |
203-264-7 |
| Molecular Structure |
|
| Boiling point |
161.2°C at 760 mmHg |
| Flash point |
32.2°C |
| Vapour Pressur |
2.3mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
