| product Name |
Anethole |
| Synonyms |
Anethole,98%; Anise camphor; 1-(p-methoxyphenyl)propene; 1-methoxy-4-(1-propenyl)benzene; 1-methoxy-4-propenylbenzene; p-1-propenylanisole; p-methoxy-beta-methylstyrene; p-propenylphenyl methyl ether; isoestragole; Methoxy-4-propenylbenzene; nauli ''gum''; oil of aniseed; Propenylanisole; Natural Anethole; 1-methoxy-4-[(1E)-prop-1-en-1-yl]benzene; 1-methoxy-4-[(1Z)-prop-1-en-1-yl]benzene |
| Molecular Formula |
C10H12O |
| Molecular Weight |
148.2017 |
| InChI |
InChI=1/C10H12O/c1-3-10(11-2)9-7-5-4-6-8-9/h3-8H,1-2H3 |
| CAS Registry Number |
104-46-1 |
| EINECS |
203-205-5 |
| Molecular Structure |
|
| Melting point |
23-22℃ |
| Refractive index |
1.514 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
