| product Name |
1-Methoxy-4-propylbenzene |
| Synonyms |
4-Propylanisole = Dihydroanethole = p-Propylanisole; 4-n-Propylanisole |
| Molecular Formula |
C10H14O |
| Molecular Weight |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number |
104-45-0 |
| EINECS |
203-203-4 |
| Molecular Structure |
|
| Density |
0.922g/cm3 |
| Boiling point |
211.4°C at 760 mmHg |
| Refractive index |
1.49 |
| Flash point |
82.3°C |
| Vapour Pressur |
0.266mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
