| product Name |
N'-Benzyl-N,N-dimethylethylenediamine |
| Synonyms |
2-benzylaminoethyldimethylamine; N?Benzyl-N,N-dimethylethylenediamine; N'-benzyl-N,N-dimethylethane-1,2-diamine; N'-benzyl-N,N-dimethylethane-1,2-diaminium |
| Molecular Formula |
C11H20N2 |
| Molecular Weight |
180.2888 |
| InChI |
InChI=1/C11H18N2/c1-13(2)9-8-12-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/p+2 |
| CAS Registry Number |
103-55-9 |
| EINECS |
203-122-4 |
| Molecular Structure |
|
| Boiling point |
254.7°C at 760 mmHg |
| Flash point |
93.3°C |
| Vapour Pressur |
0.017mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|