| product Name |
p-(p-anilinoanilino)phenol |
| Synonyms |
Phenol, 4-((4-(phenylamino)phenyl)amino)-; 4-((4-(Phenylamino)phenyl)amino)phenol; p-(p-Anilinoanilino)phenol; 4-{[4-(phenylamino)phenyl]amino}phenol |
| Molecular Formula |
C18H16N2O |
| Molecular Weight |
276.3324 |
| InChI |
InChI=1/C18H16N2O/c21-18-12-10-17(11-13-18)20-16-8-6-15(7-9-16)19-14-4-2-1-3-5-14/h1-13,19-21H |
| CAS Registry Number |
101-74-6 |
| EINECS |
202-971-8 |
| Molecular Structure |
|
| Density |
1.256g/cm3 |
| Boiling point |
484.6°C at 760 mmHg |
| Refractive index |
1.72 |
| Flash point |
170.2°C |
| Vapour Pressur |
5.15E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|