| product Name |
m-Vinyltoluene |
| Synonyms |
3-Methylstyrene; 3-Vinyltoluene |
| Molecular Formula |
C9H10 |
| Molecular Weight |
118.17 |
| InChI |
InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
| CAS Registry Number |
100-80-1 |
| EINECS |
202-889-2 |
| Molecular Structure |
|
| Density |
170 |
| Boiling point |
171℃ |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
