| product Name |
1,3-Dihydroxynaphthalene |
| Synonyms |
1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
| Molecular Formula |
C10H8O2 |
| Molecular Weight |
160.1693 |
| InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
| CAS Registry Number |
132-86-5 |
| EINECS |
205-079-7 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
123-126℃ |
| Boiling point |
361.5°C at 760 mmHg |
| Refractive index |
1.725 |
| Flash point |
185.5°C |
| Vapour Pressur |
9.93E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
