| product Name |
2-Phenyl-4-quinolinecarboxylic acid |
| Synonyms |
2-Phenylcinchoninic acid; Cinchophen~2-Phenylcinchoninic acid; Cinchophen; 2-phenylquinoline-4-carboxylic acid; 2-phenylquinoline-4-carboxylate |
| Molecular Formula |
C16H10NO2 |
| Molecular Weight |
248.2566 |
| InChI |
InChI=1/C16H11NO2/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H,(H,18,19)/p-1 |
| CAS Registry Number |
132-60-5 |
| EINECS |
205-067-1 |
| Molecular Structure |
|
| Melting point |
213-216℃ |
| Boiling point |
456.9°C at 760 mmHg |
| Flash point |
230.1°C |
| Vapour Pressur |
3.84E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
