| product Name |
2-Bromo-1-phenylpropane |
| Synonyms |
(2-Bromopropyl)benzene |
| Molecular Formula |
C9H11Br |
| Molecular Weight |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| CAS Registry Number |
2114-39-8 |
| EINECS |
218-315-9 |
| Molecular Structure |
|
| Density |
1.307g/cm3 |
| Boiling point |
228°C at 760 mmHg |
| Refractive index |
1.544 |
| Flash point |
90.6°C |
| Vapour Pressur |
0.113mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
