| product Name |
2-Iodobiphenyl |
| Synonyms |
1,1'-Biphenyl, 2-iodo-; 2-Iodo-1,1'-biphenyl; AI3-15371; Biphenyl, 2-iodo-; NSC 9283; o-Iodobiphenyl; o-Phenyliodobenzene; Biphenyl, 2-iodo- (6CI,7CI,8CI) |
| Molecular Formula |
C12H9I |
| Molecular Weight |
280.1043 |
| InChI |
InChI=1/C12H9I/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| CAS Registry Number |
2113-51-1 |
| EINECS |
218-303-3 |
| Molecular Structure |
|
| Density |
1.584g/cm3 |
| Boiling point |
331.7°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
150.1°C |
| Vapour Pressur |
0.000295mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|