product Name |
1-(4-Morpholino)-2-propanol |
Synonyms |
N-(2-Hydroxypropyl)morpholine; 1-(morpholin-4-yl)propan-2-ol; (2S)-1-morpholin-4-ylpropan-2-ol |
Molecular Formula |
C7H15NO2 |
Molecular Weight |
145.1995 |
InChI |
InChI=1/C7H15NO2/c1-7(9)6-8-2-4-10-5-3-8/h7,9H,2-6H2,1H3/t7-/m0/s1 |
CAS Registry Number |
2109-66-2 |
EINECS |
218-298-8 |
Molecular Structure |
|
Density |
1.033g/cm3 |
Boiling point |
233.6°C at 760 mmHg |
Refractive index |
1.468 |
Flash point |
95.1°C |
Vapour Pressur |
0.0102mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|