product Name |
4-Methylphenylacetone |
Synonyms |
1-(4-methylphenyl)propan-2-one |
Molecular Formula |
C10H12O |
Molecular Weight |
148.2017 |
InChI |
InChI=1/C10H12O/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6H,7H2,1-2H3 |
CAS Registry Number |
2096-86-8 |
Molecular Structure |
|
Density |
0.974g/cm3 |
Boiling point |
223.1°C at 760 mmHg |
Refractive index |
1.507 |
Flash point |
97.1°C |
Vapour Pressur |
0.0982mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|