product Name |
Piperonaldoxime |
Synonyms |
Piperonaldoxime, (3,4-Methylenedioxybenzaldoxime); 1,3-Benzodioxole-5-carboxaldoxime~3,4-(Methylenedioxy)benzaldoxime; 1-(1,3-benzodioxol-5-yl)-N-hydroxymethanimine; 1,3-benzodioxole-5-carbaldehyde oxime |
Molecular Formula |
C8H7NO3 |
Molecular Weight |
165.1461 |
InChI |
InChI=1/C8H7NO3/c10-9-4-6-1-2-7-8(3-6)12-5-11-7/h1-4,10H,5H2/b9-4+ |
CAS Registry Number |
2089-36-3 |
Molecular Structure |
|
Density |
1.38g/cm3 |
Boiling point |
279.8°C at 760 mmHg |
Refractive index |
1.603 |
Flash point |
123°C |
Vapour Pressur |
0.00187mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|