| product Name |
3-Methoxyphenoxyacetic acid |
| Synonyms |
Acetic acid, (3-methoxyphenoxy)-; (3-Methoxyphenoxy)acetic acid |
| Molecular Formula |
C9H10O4 |
| Molecular Weight |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| CAS Registry Number |
2088-24-6 |
| Molecular Structure |
|
| Density |
1.226g/cm3 |
| Boiling point |
325.9°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
131.9°C |
| Vapour Pressur |
9.11E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
