product Name |
2,2'-bithiophene-5-carboxylic acid |
Synonyms |
2,2'-Bithiophene-5-carboxylic acid; 2,2'-Bithiophene-5-CA |
Molecular Formula |
C9H6O2S2 |
Molecular Weight |
210.2727 |
InChI |
InChI=1/C9H6O2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5H,(H,10,11) |
CAS Registry Number |
2060-55-1 |
Molecular Structure |
|
Density |
1.438g/cm3 |
Melting point |
175℃ |
Boiling point |
396.1°C at 760 mmHg |
Refractive index |
1.668 |
Flash point |
193.4°C |
Vapour Pressur |
5.5E-07mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|