product Name |
4-iodophenyl isothiocyanate |
Synonyms |
4-Iodoisothiocyanatobenzene; 1-iodo-4-isothiocyanatobenzene |
Molecular Formula |
C7H4INS |
Molecular Weight |
261.0828 |
InChI |
InChI=1/C7H4INS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
CAS Registry Number |
2059-76-9 |
Molecular Structure |
|
Density |
1.76g/cm3 |
Melting point |
70-76℃ |
Boiling point |
299.5°C at 760 mmHg |
Refractive index |
1.672 |
Flash point |
134.9°C |
Vapour Pressur |
0.00212mmHg at 25°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|