product Name |
1-Methylisatin |
Synonyms |
Methylisatintech; 1-methyl-2,3-dihydroindole-2,3-dione; N-Methylsatin; 1-Methyl-2,3-indolinedione; 1-methyl-1H-indole-2,3-dione |
Molecular Formula |
C9H7NO2 |
Molecular Weight |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
CAS Registry Number |
2058-74-4 |
EINECS |
218-164-9 |
Molecular Structure |
|
Density |
1.314g/cm3 |
Melting point |
129-133℃ |
Boiling point |
294.3°C at 760 mmHg |
Refractive index |
1.607 |
Flash point |
137.4°C |
Vapour Pressur |
0.00164mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|