product Name |
D(-)-Asparagine |
Synonyms |
D-2-Aminosuccinamic acid; H-D-Asn-OH; D-asparagine anhydrous; D-Asparagine; D-2-Aminosuccinamic acid; D-asparagine; (2R)-2-aminobutanedioic acid |
Molecular Formula |
C4H8N2O3 |
Molecular Weight |
132.1191 |
InChI |
InChI:1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
CAS Registry Number |
2058-58-4 |
EINECS |
218-163-3 |
Molecular Structure |
|
Density |
1.404 g/cm3 |
Melting point |
280℃ (dec.) |
Boiling point |
361°C at 760 mmHg |
Flash point |
172.1°C |
Vapour Pressur |
2.38E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|