product Name |
4-Decanol |
Synonyms |
n-Hexyl n-propyl carbinol; decan-4-ol; (4R)-decan-4-ol; (4S)-decan-4-ol |
Molecular Formula |
C10H22O |
Molecular Weight |
158.2811 |
InChI |
InChI=1/C10H22O/c1-3-5-6-7-9-10(11)8-4-2/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
CAS Registry Number |
2051-31-2 |
EINECS |
218-117-2 |
Molecular Structure |
|
Density |
0.826g/cm3 |
Boiling point |
213.4°C at 760 mmHg |
Refractive index |
1.434 |
Flash point |
82.2°C |
Vapour Pressur |
0.0365mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|