| product Name |
n-Dodecylboronic acid |
| Synonyms |
n-Dodecaneboronic acid~Laurylboronic acid; dodecylboronic acid |
| Molecular Formula |
C12H27BO2 |
| Molecular Weight |
214.1526 |
| InChI |
InChI=1/C12H27BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h14-15H,2-12H2,1H3 |
| CAS Registry Number |
3088-79-7 |
| Molecular Structure |
|
| Density |
0.879g/cm3 |
| Boiling point |
329.8°C at 760 mmHg |
| Refractive index |
1.439 |
| Flash point |
153.2°C |
| Vapour Pressur |
1.28E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
