product Name |
4-Methylformanilide |
Synonyms |
4'-Methylformanilide; AI3-01418; Formamide, N-(4-methylphenyl)-; N-(4-methylphenyl)formamide |
Molecular Formula |
C8H9NO |
Molecular Weight |
135.1632 |
InChI |
InChI=1/C8H9NO/c1-7-2-4-8(5-3-7)9-6-10/h2-6H,1H3,(H,9,10) |
CAS Registry Number |
3085-54-9 |
EINECS |
221-400-3 |
Molecular Structure |
|
Density |
1.103g/cm3 |
Boiling point |
293.5°C at 760 mmHg |
Refractive index |
1.581 |
Flash point |
166.8°C |
Vapour Pressur |
0.00172mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|