| product Name |
4-Chlorophenyl sulfoxide |
| Synonyms |
Bis(4-chlorophenyl) sulfoxide; 4-Chlorophenyl sulphoxide~4,4-Dichlorodiphenyl sulphoxide; 4,4-Dichlorodiphenyl sulfoxide; 1,1'-sulfinylbis(4-chlorobenzene) |
| Molecular Formula |
C12H8Cl2OS |
| Molecular Weight |
271.1623 |
| InChI |
InChI=1/C12H8Cl2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
| CAS Registry Number |
3085-42-5 |
| EINECS |
221-397-9 |
| Molecular Structure |
|
| Density |
1.48g/cm3 |
| Melting point |
140-145℃ |
| Boiling point |
406.2°C at 760 mmHg |
| Refractive index |
1.689 |
| Flash point |
199.5°C |
| Vapour Pressur |
1.94E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|