| product Name |
5-Vinyl-2-norbornene |
| Synonyms |
5-Vinyl-2-norbornene,mixture of endo and exo; Vinylnorbornene; 2-ethenylbicyclo[2.2.1]hept-1-ene; 5-ethenylbicyclo[2.2.1]hept-1-ene |
| Molecular Weight |
C9H8 |
| InChI |
InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-3,8-9H,1,4-6H2 |
| CAS Registry Number |
3048-64-4 |
| EINECS |
221-259-8 |
| Molecular Structure |
|
| Density |
1.612 |
| Melting point |
-80℃ |
| Boiling point |
137.909°C |
| Refractive index |
144.1732 |
| Flash point |
1.189g/cm3 |
| Vapour Pressur |
304 |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|