product Name |
1,3-Diethoxybenzene |
Synonyms |
1,3-Diethoxybenzene, (Resorcinol diethyl ether); Resorsinol diethyl ether; Resorcinol diethyl ether |
Molecular Formula |
C10H14O2 |
Molecular Weight |
166.217 |
InChI |
InChI=1/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
CAS Registry Number |
2049-73-2 |
EINECS |
218-071-3 |
Molecular Structure |
|
Density |
0.975g/cm3 |
Melting point |
10-236℃ |
Boiling point |
238.5°C at 760 mmHg |
Refractive index |
1.485 |
Flash point |
87.1°C |
Vapour Pressur |
0.0651mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|