| product Name |
diethyl glutaconate, mixture of cis and tra |
| Synonyms |
Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester |
| Molecular Formula |
C9H14O4 |
| Molecular Weight |
186.2051 |
| InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
| CAS Registry Number |
2049-67-4 |
| EINECS |
218-069-2 |
| Molecular Structure |
|
| Density |
1.048g/cm3 |
| Boiling point |
237°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
106.7°C |
| Vapour Pressur |
0.0459mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
