| product Name |
DL-Beta-Ethylphenethyl alcohol |
| Synonyms |
2-Phenyl-1-butanol; 2-phenylbutan-1-ol; (2R)-2-phenylbutan-1-ol; (2S)-2-phenylbutan-1-ol |
| Molecular Formula |
C10H14O |
| Molecular Weight |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-2-9(8-11)10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3/t9-/m1/s1 |
| CAS Registry Number |
2035-94-1 |
| EINECS |
218-003-2 |
| Molecular Structure |
|
| Density |
0.978g/cm3 |
| Boiling point |
235°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
83.5°C |
| Vapour Pressur |
0.0283mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
