| product Name |
3,4-Dimethoxybenzonitrile |
| Synonyms |
Veratronitrile; 3,4-Dimethoybenzonitrile |
| Molecular Formula |
C9H9NO2 |
| Molecular Weight |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| CAS Registry Number |
2024-83-1 |
| EINECS |
217-969-2 |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Melting point |
66-71℃ |
| Boiling point |
266.2°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
107.5°C |
| Vapour Pressur |
0.00877mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
