| product Name |
N,N-Dimethylformamide dicyclohexyl acetal |
| Synonyms |
1,1-Dicyclohexyloxytrimethylamine; 1,1-bis(cyclohexyloxy)-N,N-dimethylmethanamine; bis(cyclohexyloxy)-N,N-dimethylmethanaminium |
| Molecular Formula |
C15H30NO2 |
| Molecular Weight |
256.4037 |
| InChI |
InChI=1/C15H29NO2/c1-16(2)15(17-13-9-5-3-6-10-13)18-14-11-7-4-8-12-14/h13-15H,3-12H2,1-2H3/p+1 |
| CAS Registry Number |
2016-05-9 |
| EINECS |
217-947-2 |
| Molecular Structure |
|
| Boiling point |
310.5°C at 760 mmHg |
| Flash point |
90.6°C |
| Vapour Pressur |
0.000596mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|