| product Name |
DL-alpha-Methyltryptamine |
| Molecular Formula |
C11H15N2 |
| Molecular Weight |
175.2497 |
| InChI |
InChI=1/C11H14N2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8,13H,6,12H2,1H3/p+1/t8-/m1/s1 |
| CAS Registry Number |
299-26-3 |
| EINECS |
206-073-7 |
| Molecular Structure |
|
| Melting point |
97-101℃ |
| Boiling point |
344.5°C at 760 mmHg |
| Flash point |
189°C |
| Vapour Pressur |
6.55E-05mmHg at 25°C |
| Hazard Symbols |
 T+:Very toxic;
|
| Risk Codes |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
