product Name |
DL-alpha-Methyltryptamine |
Molecular Formula |
C11H15N2 |
Molecular Weight |
175.2497 |
InChI |
InChI=1/C11H14N2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8,13H,6,12H2,1H3/p+1/t8-/m1/s1 |
CAS Registry Number |
299-26-3 |
EINECS |
206-073-7 |
Molecular Structure |
|
Melting point |
97-101℃ |
Boiling point |
344.5°C at 760 mmHg |
Flash point |
189°C |
Vapour Pressur |
6.55E-05mmHg at 25°C |
Hazard Symbols |
T+:Very toxic;
|
Risk Codes |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|