product Name |
Azulene |
Synonyms |
Bicyclo[5.3.0]decapentaene |
Molecular Formula |
C10H8 |
Molecular Weight |
128.1705 |
InChI |
InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
CAS Registry Number |
275-51-4 |
EINECS |
205-993-6 |
Molecular Structure |
|
Density |
1.037g/cm3 |
Melting point |
99-101℃ |
Boiling point |
220.7°C at 760 mmHg |
Refractive index |
1.632 |
Flash point |
76.7°C |
Vapour Pressur |
0.165mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|