| product Name |
n-Propyl acrylate |
| Synonyms |
n-Propyl acrylate, (Acrylic acid n-propyl ester); Acrylic acid n-propyl ester; Propyl acrylate |
| Molecular Formula |
C6H10O2 |
| Molecular Weight |
114.14 |
| InChI |
InChI=1/C6H10O2/c1-3-5-8-6(7)4-2/h4H,2-3,5H2,1H3 |
| CAS Registry Number |
925-60-0 |
| EINECS |
213-120-5 |
| Molecular Structure |
|
| Density |
43 |
| Boiling point |
43℃ (40 torr) |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
