| product Name |
Benzofurazan |
| Synonyms |
Benzofurazan; (2,1,3-Benzoxadiazole); 2,1,3-Benzoxadiazole; 2,1,3-Benzoxadiazol |
| Molecular Formula |
C6H4N2O |
| Molecular Weight |
120.1088 |
| InChI |
InChI=1/C6H4N2O/c1-2-4-6-5(3-1)7-9-8-6/h1-4H |
| CAS Registry Number |
273-09-6 |
| Molecular Structure |
|
| Density |
1.294g/cm3 |
| Boiling point |
186°C at 760 mmHg |
| Refractive index |
1.619 |
| Flash point |
70.8°C |
| Vapour Pressur |
0.929mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|