| product Name |
5-Azabenzimidazole |
| Synonyms |
1H-Imidazo[4,5-c]pyridine; 3H-imidazo[4,5-c]pyridine |
| Molecular Formula |
C6H5N3 |
| Molecular Weight |
119.124 |
| InChI |
InChI=1/C6H5N3/c1-2-7-3-6-5(1)8-4-9-6/h1-4H,(H,8,9) |
| CAS Registry Number |
272-97-9 |
| Molecular Structure |
|
| Density |
1.348g/cm3 |
| Boiling point |
425.1°C at 760 mmHg |
| Refractive index |
1.715 |
| Flash point |
224.4°C |
| Vapour Pressur |
4.85E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
