| product Name |
5H-dipyrido[3,4-b:4',3'-e][1,4]thiazine |
| Synonyms |
|
| Molecular Formula |
C10H7N3S |
| Molecular Weight |
201.2477 |
| InChI |
InChI=1/C10H7N3S/c1-3-11-5-9-7(1)13-8-2-4-12-6-10(8)14-9/h1-6,13H |
| CAS Registry Number |
262-01-1 |
| Molecular Structure |
|
| Density |
1.359g/cm3 |
| Boiling point |
437.6°C at 760 mmHg |
| Refractive index |
1.694 |
| Flash point |
218.5°C |
| Vapour Pressur |
7.38E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|