| product Name |
pentacyclo[6.4.0.0~2,7~.0~4,11~.0~5,10~]dodecane |
| Synonyms |
259-77-8; Pentacyclo[6.4.0.02,7.04,11.05,10]dodecane; Tetraasterane |
| Molecular Formula |
C12H16 |
| Molecular Weight |
160.2554 |
| InChI |
InChI=1/C12H16/c1-5-7-2-8-6(1)10-3-9(5)11(7)4-12(8)10/h5-12H,1-4H2 |
| CAS Registry Number |
259-77-8 |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Boiling point |
228.7°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
71.5°C |
| Vapour Pressur |
0.109mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|